C29H38O5 — CID 11798434
[(5S,9R,13S,14S,15S,16R)-5-(acetyloxymethyl)-16-hydroxy-5,9,14-trimethyl-15-tetracyclo[11.2.1.01,10.04,9]hexadec-11-enyl] benzoate (PubChem CID 11798434) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is [(5S,9R,13S,14S,15S,16R)-5-(acetyloxymethyl)-16-hydroxy-5,9,14-trimethyl-15-tetracyclo[11.2.1.01,10.04,9]hexadec-11-enyl] benzoate.
| Compound Name | [(5S,9R,13S,14S,15S,16R)-5-(acetyloxymethyl)-16-hydroxy-5,9,14-trimethyl-15-tetracyclo[11.2.1.01,10.04,9]hexadec-11-enyl] benzoate |
|---|---|
| PubChem CID | 11798434 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [(5S,9R,13S,14S,15S,16R)-5-(acetyloxymethyl)-16-hydroxy-5,9,14-trimethyl-15-tetracyclo[11.2.1.01,10.04,9]hexadec-11-enyl] benzoate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@@]2(C)C3C=C[C@H]4[C@H](C)[C@H](OC(=O)c5ccccc5)C3(CCC12)[C@@H]4O |
| InChI | InChI=1S/C29H38O5/c1-18-21-11-12-23-28(4)15-8-14-27(3,17-33-19(2)30)22(28)13-16-29(23,24(21)31)25(18)34-26(32)20-9-6-5-7-10-20/h5-7,9-12,18,21-25,31H,8,13-17H2,1-4H3/t18-,21-,22?,23?,24+,25-,27+,28+,29?/m0/s1 |
| InChIKey | ZBBIYJFYUKUNAB-SGVPASHVSA-N |
| XLogP | 5.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|