C30H35NO4 — CID 174181867
(10-benzoyloxy-2,3,6,7,12-pentamethyl-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-9-yl) benzoate (PubChem CID 174181867) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (10-benzoyloxy-2,3,6,7,12-pentamethyl-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-9-yl) benzoate.
| Compound Name | (10-benzoyloxy-2,3,6,7,12-pentamethyl-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-9-yl) benzoate |
|---|---|
| PubChem CID | 174181867 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (10-benzoyloxy-2,3,6,7,12-pentamethyl-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-9-yl) benzoate |
| SMILES | CC1C2(C)CCC1(C)C1(C)C3NC(C(OC(=O)c4ccccc4)C3OC(=O)c3ccccc3)C21C |
| InChI | InChI=1S/C30H35NO4/c1-18-27(2)16-17-28(18,3)30(5)24-22(35-26(33)20-14-10-7-11-15-20)21(23(31-24)29(27,30)4)34-25(32)19-12-8-6-9-13-19/h6-15,18,21-24,31H,16-17H2,1-5H3 |
| InChIKey | LZAPAVPJODTORL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |