C21H34O4 — CID 163019044
2-[7-(methoxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid (PubChem CID 163019044) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-[7-(methoxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid.
| Compound Name | 2-[7-(methoxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 163019044 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 2-[7-(methoxymethyl)-2',4,4,8a-tetramethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid |
| SMILES | COCC1=CCC2C(C)(C)CCCC2(C)C12CCC(C)(CC(=O)O)O2 |
| InChI | InChI=1S/C21H34O4/c1-18(2)9-6-10-20(4)16(18)8-7-15(14-24-5)21(20)12-11-19(3,25-21)13-17(22)23/h7,16H,6,8-14H2,1-5H3,(H,22,23) |
| InChIKey | HIMKMNPGLLJADY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|