C25H40O5 — CID 162874545
2-[2',4,7,8a-tetramethyl-4-(2-methylbutanoyloxymethyl)spiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid (PubChem CID 162874545) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 2-[2',4,7,8a-tetramethyl-4-(2-methylbutanoyloxymethyl)spiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid.
| Compound Name | 2-[2',4,7,8a-tetramethyl-4-(2-methylbutanoyloxymethyl)spiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 162874545 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 2-[2',4,7,8a-tetramethyl-4-(2-methylbutanoyloxymethyl)spiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-yl]acetic acid |
| SMILES | CCC(C)C(=O)OCC1(C)CCCC2(C)C1CC=C(C)C21CCC(C)(CC(=O)O)O1 |
| InChI | InChI=1S/C25H40O5/c1-7-17(2)21(28)29-16-22(4)11-8-12-24(6)19(22)10-9-18(3)25(24)14-13-23(5,30-25)15-20(26)27/h9,17,19H,7-8,10-16H2,1-6H3,(H,26,27) |
| InChIKey | DZNUEDKLEOFKGM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|