C15H19ClO4S — CID 107090458
2-chloro-4-(3-ethylcyclohexyl)sulfonylbenzoic acid (PubChem CID 107090458) has the molecular formula C15H19ClO4S and a molecular weight of 330.83 g/mol. Its IUPAC name is 2-chloro-4-(3-ethylcyclohexyl)sulfonylbenzoic acid.
| Compound Name | 2-chloro-4-(3-ethylcyclohexyl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107090458 |
| Molecular Formula | C15H19ClO4S |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-chloro-4-(3-ethylcyclohexyl)sulfonylbenzoic acid |
| SMILES | CCC1CCCC(S(=O)(=O)c2ccc(C(=O)O)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19ClO4S/c1-2-10-4-3-5-11(8-10)21(19,20)12-6-7-13(15(17)18)14(16)9-12/h6-7,9-11H,2-5,8H2,1H3,(H,17,18) |
| InChIKey | LBWKSHIRRPWJAJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |