C16H25ClN2O2S — CID 107092301
tert-butyl 3-[2-(5-chlorothiophen-2-yl)-1-(methylamino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 107092301) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is tert-butyl 3-[2-(5-chlorothiophen-2-yl)-1-(methylamino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(5-chlorothiophen-2-yl)-1-(methylamino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092301 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | tert-butyl 3-[2-(5-chlorothiophen-2-yl)-1-(methylamino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CNC(Cc1ccc(Cl)s1)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-16(2,3)21-15(20)19-8-7-11(10-19)13(18-4)9-12-5-6-14(17)22-12/h5-6,11,13,18H,7-10H2,1-4H3 |
| InChIKey | ZADJVKARJQIMMP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |