C17H27BrN2O2S — CID 107092337
tert-butyl 3-[2-(3-bromothiophen-2-yl)-1-(ethylamino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 107092337) has the molecular formula C17H27BrN2O2S and a molecular weight of 403.39 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-bromothiophen-2-yl)-1-(ethylamino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-bromothiophen-2-yl)-1-(ethylamino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092337 |
| Molecular Formula | C17H27BrN2O2S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | tert-butyl 3-[2-(3-bromothiophen-2-yl)-1-(ethylamino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCNC(Cc1sccc1Br)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H27BrN2O2S/c1-5-19-14(10-15-13(18)7-9-23-15)12-6-8-20(11-12)16(21)22-17(2,3)4/h7,9,12,14,19H,5-6,8,10-11H2,1-4H3 |
| InChIKey | KXTACTDZTOMJNN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |