C16H30N2O2 — CID 107092544
tert-butyl 3-[1-(ethylamino)-3-methylbut-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 107092544) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is tert-butyl 3-[1-(ethylamino)-3-methylbut-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(ethylamino)-3-methylbut-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092544 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | tert-butyl 3-[1-(ethylamino)-3-methylbut-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCNC(C=C(C)C)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-7-17-14(10-12(2)3)13-8-9-18(11-13)15(19)20-16(4,5)6/h10,13-14,17H,7-9,11H2,1-6H3 |
| InChIKey | AYVXILCUULSAGF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|