C19H36N2O2 — CID 107092463
tert-butyl 3-[ethylamino-(4-methylcyclohexyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 107092463) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is tert-butyl 3-[ethylamino-(4-methylcyclohexyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[ethylamino-(4-methylcyclohexyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092463 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tert-butyl 3-[ethylamino-(4-methylcyclohexyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCNC(C1CCC(C)CC1)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H36N2O2/c1-6-20-17(15-9-7-14(2)8-10-15)16-11-12-21(13-16)18(22)23-19(3,4)5/h14-17,20H,6-13H2,1-5H3 |
| InChIKey | ZZERDZPODVUAIV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |