C17H24BrFN2O2 — CID 107092311
tert-butyl 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 107092311) has the molecular formula C17H24BrFN2O2 and a molecular weight of 387.29 g/mol. Its IUPAC name is tert-butyl 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092311 |
| Molecular Formula | C17H24BrFN2O2 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | tert-butyl 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(N)Cc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C17H24BrFN2O2/c1-17(2,3)23-16(22)21-7-6-12(10-21)15(20)8-11-4-5-13(18)9-14(11)19/h4-5,9,12,15H,6-8,10,20H2,1-3H3 |
| InChIKey | VIWTXEBKPVWQJE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |