C16H23Cl2N3O2 — CID 107093075
tert-butyl 3-[(3,4-dichlorophenyl)-hydrazinylmethyl]pyrrolidine-1-carboxylate (PubChem CID 107093075) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is tert-butyl 3-[(3,4-dichlorophenyl)-hydrazinylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3,4-dichlorophenyl)-hydrazinylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107093075 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | tert-butyl 3-[(3,4-dichlorophenyl)-hydrazinylmethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(NN)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H23Cl2N3O2/c1-16(2,3)23-15(22)21-7-6-11(9-21)14(20-19)10-4-5-12(17)13(18)8-10/h4-5,8,11,14,20H,6-7,9,19H2,1-3H3 |
| InChIKey | JBFWNHJXMFZOES-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|