C13H21BrOSi — CID 10709415
bromomethyl-(5,5-dimethylocta-1,7-diyn-3-yloxy)-dimethylsilane (PubChem CID 10709415) has the molecular formula C13H21BrOSi and a molecular weight of 301.30 g/mol. Its IUPAC name is bromomethyl-(5,5-dimethylocta-1,7-diyn-3-yloxy)-dimethylsilane.
| Compound Name | bromomethyl-(5,5-dimethylocta-1,7-diyn-3-yloxy)-dimethylsilane |
|---|---|
| PubChem CID | 10709415 |
| Molecular Formula | C13H21BrOSi |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | bromomethyl-(5,5-dimethylocta-1,7-diyn-3-yloxy)-dimethylsilane |
| SMILES | C#CCC(C)(C)CC(C#C)O[Si](C)(C)CBr |
| InChI | InChI=1S/C13H21BrOSi/c1-7-9-13(3,4)10-12(8-2)15-16(5,6)11-14/h1-2,12H,9-11H2,3-6H3 |
| InChIKey | AVXUHJVFQUUYPQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|