C17H29BrOSi — CID 10713336
bromomethyl-dimethyl-(2,2,7,7-tetramethyldeca-3,9-diyn-5-yloxy)silane (PubChem CID 10713336) has the molecular formula C17H29BrOSi and a molecular weight of 357.41 g/mol. Its IUPAC name is bromomethyl-dimethyl-(2,2,7,7-tetramethyldeca-3,9-diyn-5-yloxy)silane.
| Compound Name | bromomethyl-dimethyl-(2,2,7,7-tetramethyldeca-3,9-diyn-5-yloxy)silane |
|---|---|
| PubChem CID | 10713336 |
| Molecular Formula | C17H29BrOSi |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | bromomethyl-dimethyl-(2,2,7,7-tetramethyldeca-3,9-diyn-5-yloxy)silane |
| SMILES | C#CCC(C)(C)CC(C#CC(C)(C)C)O[Si](C)(C)CBr |
| InChI | InChI=1S/C17H29BrOSi/c1-9-11-17(5,6)13-15(10-12-16(2,3)4)19-20(7,8)14-18/h1,15H,11,13-14H2,2-8H3 |
| InChIKey | PUHOYONWTPDZLG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|