C18H31BrOSi — CID 10714274
bromomethyl-dimethyl-(2,2,5,7,7-pentamethyldeca-3,9-diyn-5-yloxy)silane (PubChem CID 10714274) has the molecular formula C18H31BrOSi and a molecular weight of 371.44 g/mol. Its IUPAC name is bromomethyl-dimethyl-(2,2,5,7,7-pentamethyldeca-3,9-diyn-5-yloxy)silane.
| Compound Name | bromomethyl-dimethyl-(2,2,5,7,7-pentamethyldeca-3,9-diyn-5-yloxy)silane |
|---|---|
| PubChem CID | 10714274 |
| Molecular Formula | C18H31BrOSi |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | bromomethyl-dimethyl-(2,2,5,7,7-pentamethyldeca-3,9-diyn-5-yloxy)silane |
| SMILES | C#CCC(C)(C)CC(C)(C#CC(C)(C)C)O[Si](C)(C)CBr |
| InChI | InChI=1S/C18H31BrOSi/c1-10-11-17(5,6)14-18(7,13-12-16(2,3)4)20-21(8,9)15-19/h1H,11,14-15H2,2-9H3 |
| InChIKey | BAQDJZYOOUTOEA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|