C20H35BrOSi — CID 10763460
bromomethyl-dimethyl-(2,2,7,7-tetramethyl-5-propan-2-yldeca-3,9-diyn-5-yl)oxysilane (PubChem CID 10763460) has the molecular formula C20H35BrOSi and a molecular weight of 399.49 g/mol. Its IUPAC name is bromomethyl-dimethyl-(2,2,7,7-tetramethyl-5-propan-2-yldeca-3,9-diyn-5-yl)oxysilane.
| Compound Name | bromomethyl-dimethyl-(2,2,7,7-tetramethyl-5-propan-2-yldeca-3,9-diyn-5-yl)oxysilane |
|---|---|
| PubChem CID | 10763460 |
| Molecular Formula | C20H35BrOSi |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | bromomethyl-dimethyl-(2,2,7,7-tetramethyl-5-propan-2-yldeca-3,9-diyn-5-yl)oxysilane |
| SMILES | C#CCC(C)(C)CC(C#CC(C)(C)C)(O[Si](C)(C)CBr)C(C)C |
| InChI | InChI=1S/C20H35BrOSi/c1-11-12-19(7,8)15-20(17(2)3,14-13-18(4,5)6)22-23(9,10)16-21/h1,17H,12,15-16H2,2-10H3 |
| InChIKey | QLUAOARZKRDBQG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|