C19H33BrOSi — CID 10620114
bromomethyl-(5-ethyl-2,2,7,7-tetramethyldeca-3,9-diyn-5-yl)oxy-dimethylsilane (PubChem CID 10620114) has the molecular formula C19H33BrOSi and a molecular weight of 385.46 g/mol. Its IUPAC name is bromomethyl-(5-ethyl-2,2,7,7-tetramethyldeca-3,9-diyn-5-yl)oxy-dimethylsilane.
| Compound Name | bromomethyl-(5-ethyl-2,2,7,7-tetramethyldeca-3,9-diyn-5-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 10620114 |
| Molecular Formula | C19H33BrOSi |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | bromomethyl-(5-ethyl-2,2,7,7-tetramethyldeca-3,9-diyn-5-yl)oxy-dimethylsilane |
| SMILES | C#CCC(C)(C)CC(C#CC(C)(C)C)(CC)O[Si](C)(C)CBr |
| InChI | InChI=1S/C19H33BrOSi/c1-10-12-18(6,7)15-19(11-2,14-13-17(3,4)5)21-22(8,9)16-20/h1H,11-12,15-16H2,2-9H3 |
| InChIKey | LLFCXRDALILWKK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|