C16H27NO — CID 107095044
3,3-dimethyl-4-(3-phenylbutylamino)butan-1-ol (PubChem CID 107095044) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 3,3-dimethyl-4-(3-phenylbutylamino)butan-1-ol.
| Compound Name | 3,3-dimethyl-4-(3-phenylbutylamino)butan-1-ol |
|---|---|
| PubChem CID | 107095044 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3,3-dimethyl-4-(3-phenylbutylamino)butan-1-ol |
| SMILES | CC(CCNCC(C)(C)CCO)c1ccccc1 |
| InChI | InChI=1S/C16H27NO/c1-14(15-7-5-4-6-8-15)9-11-17-13-16(2,3)10-12-18/h4-8,14,17-18H,9-13H2,1-3H3 |
| InChIKey | BYYHXCMIGPWKMU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|