C18H31NO — CID 103921676
4-[(3,3-dimethyl-1-phenylbutyl)amino]-3,3-dimethylbutan-1-ol (PubChem CID 103921676) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[(3,3-dimethyl-1-phenylbutyl)amino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[(3,3-dimethyl-1-phenylbutyl)amino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103921676 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-[(3,3-dimethyl-1-phenylbutyl)amino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)CC(NCC(C)(C)CCO)c1ccccc1 |
| InChI | InChI=1S/C18H31NO/c1-17(2,3)13-16(15-9-7-6-8-10-15)19-14-18(4,5)11-12-20/h6-10,16,19-20H,11-14H2,1-5H3 |
| InChIKey | NOXBMVFGTFHYJA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |