C17H29NO — CID 103911194
4,4-dimethyl-5-[(2-methyl-1-phenylpropyl)amino]pentan-1-ol (PubChem CID 103911194) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 4,4-dimethyl-5-[(2-methyl-1-phenylpropyl)amino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-5-[(2-methyl-1-phenylpropyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 103911194 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4,4-dimethyl-5-[(2-methyl-1-phenylpropyl)amino]pentan-1-ol |
| SMILES | CC(C)C(NCC(C)(C)CCCO)c1ccccc1 |
| InChI | InChI=1S/C17H29NO/c1-14(2)16(15-9-6-5-7-10-15)18-13-17(3,4)11-8-12-19/h5-7,9-10,14,16,18-19H,8,11-13H2,1-4H3 |
| InChIKey | OJHQHXXPKWYKMV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |