C15H21ClN2O — CID 107098111
(3-chloro-2-methylphenyl)-[2-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 107098111) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is (3-chloro-2-methylphenyl)-[2-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-2-methylphenyl)-[2-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107098111 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3-chloro-2-methylphenyl)-[2-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNCC1CCCCN1C(=O)c1cccc(Cl)c1C |
| InChI | InChI=1S/C15H21ClN2O/c1-11-13(7-5-8-14(11)16)15(19)18-9-4-3-6-12(18)10-17-2/h5,7-8,12,17H,3-4,6,9-10H2,1-2H3 |
| InChIKey | ROMNMZMQQILAAJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |