C13H20N2OS — CID 79808516
[2-(methylaminomethyl)piperidin-1-yl]-(4-methylthiophen-3-yl)methanone (PubChem CID 79808516) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is [2-(methylaminomethyl)piperidin-1-yl]-(4-methylthiophen-3-yl)methanone.
| Compound Name | [2-(methylaminomethyl)piperidin-1-yl]-(4-methylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 79808516 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [2-(methylaminomethyl)piperidin-1-yl]-(4-methylthiophen-3-yl)methanone |
| SMILES | CNCC1CCCCN1C(=O)c1cscc1C |
| InChI | InChI=1S/C13H20N2OS/c1-10-8-17-9-12(10)13(16)15-6-4-3-5-11(15)7-14-2/h8-9,11,14H,3-7H2,1-2H3 |
| InChIKey | WPTCRGOHYJBYNZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |