C15H17BrF2N2O — CID 107098632
3-[(5-bromo-2,3-difluorophenoxy)methyl]-1-pentan-3-ylpyrazole (PubChem CID 107098632) has the molecular formula C15H17BrF2N2O and a molecular weight of 359.21 g/mol. Its IUPAC name is 3-[(5-bromo-2,3-difluorophenoxy)methyl]-1-pentan-3-ylpyrazole.
| Compound Name | 3-[(5-bromo-2,3-difluorophenoxy)methyl]-1-pentan-3-ylpyrazole |
|---|---|
| PubChem CID | 107098632 |
| Molecular Formula | C15H17BrF2N2O |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-[(5-bromo-2,3-difluorophenoxy)methyl]-1-pentan-3-ylpyrazole |
| SMILES | CCC(CC)n1ccc(COc2cc(Br)cc(F)c2F)n1 |
| InChI | InChI=1S/C15H17BrF2N2O/c1-3-12(4-2)20-6-5-11(19-20)9-21-14-8-10(16)7-13(17)15(14)18/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | YKVZHJRYOQNWRM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|