C12H6BrF2NO4S — CID 107099850
1-[5-(5-bromo-2,3-difluorophenoxy)-4-nitrothiophen-2-yl]ethanone (PubChem CID 107099850) has the molecular formula C12H6BrF2NO4S and a molecular weight of 378.15 g/mol. Its IUPAC name is 1-[5-(5-bromo-2,3-difluorophenoxy)-4-nitrothiophen-2-yl]ethanone.
| Compound Name | 1-[5-(5-bromo-2,3-difluorophenoxy)-4-nitrothiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 107099850 |
| Molecular Formula | C12H6BrF2NO4S |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 1-[5-(5-bromo-2,3-difluorophenoxy)-4-nitrothiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(Oc2cc(Br)cc(F)c2F)s1 |
| InChI | InChI=1S/C12H6BrF2NO4S/c1-5(17)10-4-8(16(18)19)12(21-10)20-9-3-6(13)2-7(14)11(9)15/h2-4H,1H3 |
| InChIKey | YDHMJGITZWJTFV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|