C14H8BrClF2N2O — CID 107100284
2-(5-bromo-2,3-difluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine (PubChem CID 107100284) has the molecular formula C14H8BrClF2N2O and a molecular weight of 373.58 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 107100284 |
| Molecular Formula | C14H8BrClF2N2O |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine |
| SMILES | Fc1cc(Br)cc(Oc2nc3ccccn3c2CCl)c1F |
| InChI | InChI=1S/C14H8BrClF2N2O/c15-8-5-9(17)13(18)11(6-8)21-14-10(7-16)20-4-2-1-3-12(20)19-14/h1-6H,7H2 |
| InChIKey | QQKIHGNLPUJURM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|