C10H5BrF2O3 — CID 107100695
2-(4-bromo-6,7-difluoro-1-benzofuran-3-yl)acetic acid (PubChem CID 107100695) has the molecular formula C10H5BrF2O3 and a molecular weight of 291.05 g/mol. Its IUPAC name is 2-(4-bromo-6,7-difluoro-1-benzofuran-3-yl)acetic acid.
| Compound Name | 2-(4-bromo-6,7-difluoro-1-benzofuran-3-yl)acetic acid |
|---|---|
| PubChem CID | 107100695 |
| Molecular Formula | C10H5BrF2O3 |
| Molecular Weight | 291.05 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 2-(4-bromo-6,7-difluoro-1-benzofuran-3-yl)acetic acid |
| SMILES | O=C(O)Cc1coc2c(F)c(F)cc(Br)c12 |
| InChI | InChI=1S/C10H5BrF2O3/c11-5-2-6(12)9(13)10-8(5)4(3-16-10)1-7(14)15/h2-3H,1H2,(H,14,15) |
| InChIKey | ZOZMZGSELKBVEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.05 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|