C14H11BrF3NO — CID 107101708
N-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-3-fluoroaniline (PubChem CID 107101708) has the molecular formula C14H11BrF3NO and a molecular weight of 346.15 g/mol. Its IUPAC name is N-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-3-fluoroaniline.
| Compound Name | N-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 107101708 |
| Molecular Formula | C14H11BrF3NO |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-3-fluoroaniline |
| SMILES | Fc1cccc(NCCOc2cc(Br)cc(F)c2F)c1 |
| InChI | InChI=1S/C14H11BrF3NO/c15-9-6-12(17)14(18)13(7-9)20-5-4-19-11-3-1-2-10(16)8-11/h1-3,6-8,19H,4-5H2 |
| InChIKey | MVYHGRDMPFEYQJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|