C15H15Cl2NO2 — CID 10710205
(1R,5R)-2-benzyl-4,4-dichloro-2-azabicyclo[3.3.1]nonane-3,6-dione (PubChem CID 10710205) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is (1R,5R)-2-benzyl-4,4-dichloro-2-azabicyclo[3.3.1]nonane-3,6-dione.
| Compound Name | (1R,5R)-2-benzyl-4,4-dichloro-2-azabicyclo[3.3.1]nonane-3,6-dione |
|---|---|
| PubChem CID | 10710205 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (1R,5R)-2-benzyl-4,4-dichloro-2-azabicyclo[3.3.1]nonane-3,6-dione |
| SMILES | O=C1CC[C@@H]2C[C@H]1C(Cl)(Cl)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H15Cl2NO2/c16-15(17)12-8-11(6-7-13(12)19)18(14(15)20)9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12-/m1/s1 |
| InChIKey | IBTKRNNOLOZJBC-VXGBXAGGSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|