C11H14BrN3O4 — CID 107104248
2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(oxan-4-yl)acetamide (PubChem CID 107104248) has the molecular formula C11H14BrN3O4 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(oxan-4-yl)acetamide.
| Compound Name | 2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 107104248 |
| Molecular Formula | C11H14BrN3O4 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(oxan-4-yl)acetamide |
| SMILES | O=C(Cn1c(=O)[nH]cc(Br)c1=O)NC1CCOCC1 |
| InChI | InChI=1S/C11H14BrN3O4/c12-8-5-13-11(18)15(10(8)17)6-9(16)14-7-1-3-19-4-2-7/h5,7H,1-4,6H2,(H,13,18)(H,14,16) |
| InChIKey | SPBOSKHMRLBBQZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |