C13H19N3O4 — CID 63811876
2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(oxan-4-yl)acetamide (PubChem CID 63811876) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(oxan-4-yl)acetamide.
| Compound Name | 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 63811876 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(oxan-4-yl)acetamide |
| SMILES | CCn1ccc(=O)n(CC(=O)NC2CCOCC2)c1=O |
| InChI | InChI=1S/C13H19N3O4/c1-2-15-6-3-12(18)16(13(15)19)9-11(17)14-10-4-7-20-8-5-10/h3,6,10H,2,4-5,7-9H2,1H3,(H,14,17) |
| InChIKey | JIGKWBQZXZTDSQ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |