C16H32O4Si — CID 10710547
(2R,3S,4R)-5-methyl-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 10710547) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (2R,3S,4R)-5-methyl-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2R,3S,4R)-5-methyl-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 10710547 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (2R,3S,4R)-5-methyl-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CC1=CO[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O4Si/c1-10(2)21(11(3)4,12(5)6)20-9-14-16(18)15(17)13(7)8-19-14/h8,10-12,14-18H,9H2,1-7H3/t14-,15-,16-/m1/s1 |
| InChIKey | VNZPFWGAWIVJSN-BZUAXINKSA-N |
| XLogP | 3.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|