C12H24O4Si — CID 166177058
(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 166177058) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 166177058 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC=CC(O)[C@H]1O |
| InChI | InChI=1S/C12H24O4Si/c1-12(2,3)17(4,5)16-8-10-11(14)9(13)6-7-15-10/h6-7,9-11,13-14H,8H2,1-5H3/t9?,10-,11-/m1/s1 |
| InChIKey | HYSBQWOHQIVUQQ-FHZGLPGMSA-N |
| XLogP | 1.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|