C13H22N2 — CID 107105504
2-(aminomethyl)-N,6-dimethyl-N-(2-methylpropyl)aniline (PubChem CID 107105504) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(aminomethyl)-N,6-dimethyl-N-(2-methylpropyl)aniline.
| Compound Name | 2-(aminomethyl)-N,6-dimethyl-N-(2-methylpropyl)aniline |
|---|---|
| PubChem CID | 107105504 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-(aminomethyl)-N,6-dimethyl-N-(2-methylpropyl)aniline |
| SMILES | Cc1cccc(CN)c1N(C)CC(C)C |
| InChI | InChI=1S/C13H22N2/c1-10(2)9-15(4)13-11(3)6-5-7-12(13)8-14/h5-7,10H,8-9,14H2,1-4H3 |
| InChIKey | IETMJZMQYFCMED-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |