C12H20N2O — CID 107105810
2-[2-(aminomethyl)-N,6-dimethylanilino]propan-1-ol (PubChem CID 107105810) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-N,6-dimethylanilino]propan-1-ol.
| Compound Name | 2-[2-(aminomethyl)-N,6-dimethylanilino]propan-1-ol |
|---|---|
| PubChem CID | 107105810 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-[2-(aminomethyl)-N,6-dimethylanilino]propan-1-ol |
| SMILES | Cc1cccc(CN)c1N(C)C(C)CO |
| InChI | InChI=1S/C12H20N2O/c1-9-5-4-6-11(7-13)12(9)14(3)10(2)8-15/h4-6,10,15H,7-8,13H2,1-3H3 |
| InChIKey | PBOBYBDPURMVQG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |