C13H14N2O2 — CID 107106014
1-(2-cyano-6-methylphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 107106014) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(2-cyano-6-methylphenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-cyano-6-methylphenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107106014 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-(2-cyano-6-methylphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cccc(C#N)c1N1CCCC1C(=O)O |
| InChI | InChI=1S/C13H14N2O2/c1-9-4-2-5-10(8-14)12(9)15-7-3-6-11(15)13(16)17/h2,4-5,11H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | FOFHFTYXUQZFRK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |