C15H20N2 — CID 107107004
3-methyl-2-(2-propan-2-ylpyrrolidin-1-yl)benzonitrile (PubChem CID 107107004) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-methyl-2-(2-propan-2-ylpyrrolidin-1-yl)benzonitrile.
| Compound Name | 3-methyl-2-(2-propan-2-ylpyrrolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 107107004 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-methyl-2-(2-propan-2-ylpyrrolidin-1-yl)benzonitrile |
| SMILES | Cc1cccc(C#N)c1N1CCCC1C(C)C |
| InChI | InChI=1S/C15H20N2/c1-11(2)14-8-5-9-17(14)15-12(3)6-4-7-13(15)10-16/h4,6-7,11,14H,5,8-9H2,1-3H3 |
| InChIKey | MVZRWDVZMAHRHI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |