C14H18N2 — CID 107107056
2-(3,3-dimethylpyrrolidin-1-yl)-3-methylbenzonitrile (PubChem CID 107107056) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(3,3-dimethylpyrrolidin-1-yl)-3-methylbenzonitrile.
| Compound Name | 2-(3,3-dimethylpyrrolidin-1-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 107107056 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-(3,3-dimethylpyrrolidin-1-yl)-3-methylbenzonitrile |
| SMILES | Cc1cccc(C#N)c1N1CCC(C)(C)C1 |
| InChI | InChI=1S/C14H18N2/c1-11-5-4-6-12(9-15)13(11)16-8-7-14(2,3)10-16/h4-6H,7-8,10H2,1-3H3 |
| InChIKey | XPCFYJIQFJMADO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |