C13H16N2 — CID 102816849
3-(3,3-dimethylpyrrolidin-1-yl)benzonitrile (PubChem CID 102816849) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is 3-(3,3-dimethylpyrrolidin-1-yl)benzonitrile.
| Compound Name | 3-(3,3-dimethylpyrrolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 102816849 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-(3,3-dimethylpyrrolidin-1-yl)benzonitrile |
| SMILES | CC1(C)CCN(c2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C13H16N2/c1-13(2)6-7-15(10-13)12-5-3-4-11(8-12)9-14/h3-5,8H,6-7,10H2,1-2H3 |
| InChIKey | VTKRMEOBNQYNQO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |