C15H17N3 — CID 107107403
2-(3,5-diethylpyrazol-1-yl)-3-methylbenzonitrile (PubChem CID 107107403) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(3,5-diethylpyrazol-1-yl)-3-methylbenzonitrile.
| Compound Name | 2-(3,5-diethylpyrazol-1-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 107107403 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(3,5-diethylpyrazol-1-yl)-3-methylbenzonitrile |
| SMILES | CCc1cc(CC)n(-c2c(C)cccc2C#N)n1 |
| InChI | InChI=1S/C15H17N3/c1-4-13-9-14(5-2)18(17-13)15-11(3)7-6-8-12(15)10-16/h6-9H,4-5H2,1-3H3 |
| InChIKey | LFPATNGAKXHRGU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |