C16H21N3 — CID 82693965
5-(3,5-diethylpyrazol-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 82693965) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 5-(3,5-diethylpyrazol-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(3,5-diethylpyrazol-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82693965 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 5-(3,5-diethylpyrazol-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCc1cc(CC)n(-c2cccc3c2CCCN3)n1 |
| InChI | InChI=1S/C16H21N3/c1-3-12-11-13(4-2)19(18-12)16-9-5-8-15-14(16)7-6-10-17-15/h5,8-9,11,17H,3-4,6-7,10H2,1-2H3 |
| InChIKey | XLROTQNNTISGII-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |