C16H22N2S — CID 107108357
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-methylbenzenecarbothioamide (PubChem CID 107108357) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-methylbenzenecarbothioamide.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107108357 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-methylbenzenecarbothioamide |
| SMILES | Cc1cccc(C(N)=S)c1N1CCCC2CCCC21 |
| InChI | InChI=1S/C16H22N2S/c1-11-5-2-8-13(16(17)19)15(11)18-10-4-7-12-6-3-9-14(12)18/h2,5,8,12,14H,3-4,6-7,9-10H2,1H3,(H2,17,19) |
| InChIKey | QTRZSSULOZUQJH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|