C14H21N3O2S — CID 107108545
2-(2-carbamothioyl-6-methylanilino)-N-(2-methoxyethyl)propanamide (PubChem CID 107108545) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(2-carbamothioyl-6-methylanilino)-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-(2-carbamothioyl-6-methylanilino)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 107108545 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-(2-carbamothioyl-6-methylanilino)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Nc1c(C)cccc1C(N)=S |
| InChI | InChI=1S/C14H21N3O2S/c1-9-5-4-6-11(13(15)20)12(9)17-10(2)14(18)16-7-8-19-3/h4-6,10,17H,7-8H2,1-3H3,(H2,15,20)(H,16,18) |
| InChIKey | OFQPYYHWKQSQBD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|