C15H17IN4O — CID 107109167
[4-(3-aminopyrazol-1-yl)piperidin-1-yl]-(4-iodophenyl)methanone (PubChem CID 107109167) has the molecular formula C15H17IN4O and a molecular weight of 396.23 g/mol. Its IUPAC name is [4-(3-aminopyrazol-1-yl)piperidin-1-yl]-(4-iodophenyl)methanone.
| Compound Name | [4-(3-aminopyrazol-1-yl)piperidin-1-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 107109167 |
| Molecular Formula | C15H17IN4O |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | [4-(3-aminopyrazol-1-yl)piperidin-1-yl]-(4-iodophenyl)methanone |
| SMILES | Nc1ccn(C2CCN(C(=O)c3ccc(I)cc3)CC2)n1 |
| InChI | InChI=1S/C15H17IN4O/c16-12-3-1-11(2-4-12)15(21)19-8-5-13(6-9-19)20-10-7-14(17)18-20/h1-4,7,10,13H,5-6,8-9H2,(H2,17,18) |
| InChIKey | XTWAWYVIVVOBJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|