C16H22N4O — CID 145081662
[3-(3-aminopyrazol-1-yl)azetidin-1-yl]-(4-methylphenyl)methanone;ethane (PubChem CID 145081662) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is [3-(3-aminopyrazol-1-yl)azetidin-1-yl]-(4-methylphenyl)methanone;ethane.
| Compound Name | [3-(3-aminopyrazol-1-yl)azetidin-1-yl]-(4-methylphenyl)methanone;ethane |
|---|---|
| PubChem CID | 145081662 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [3-(3-aminopyrazol-1-yl)azetidin-1-yl]-(4-methylphenyl)methanone;ethane |
| SMILES | CC.Cc1ccc(C(=O)N2CC(n3ccc(N)n3)C2)cc1 |
| InChI | InChI=1S/C14H16N4O.C2H6/c1-10-2-4-11(5-3-10)14(19)17-8-12(9-17)18-7-6-13(15)16-18;1-2/h2-7,12H,8-9H2,1H3,(H2,15,16);1-2H3 |
| InChIKey | CZJROELJVQBNNL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |