C15H23NO3 — CID 177155026
ethane;formic acid;(3-methylazetidin-1-yl)-(4-methylphenyl)methanone (PubChem CID 177155026) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is ethane;formic acid;(3-methylazetidin-1-yl)-(4-methylphenyl)methanone.
| Compound Name | ethane;formic acid;(3-methylazetidin-1-yl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 177155026 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | ethane;formic acid;(3-methylazetidin-1-yl)-(4-methylphenyl)methanone |
| SMILES | CC.Cc1ccc(C(=O)N2CC(C)C2)cc1.O=CO |
| InChI | InChI=1S/C12H15NO.C2H6.CH2O2/c1-9-3-5-11(6-4-9)12(14)13-7-10(2)8-13;1-2;2-1-3/h3-6,10H,7-8H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | URQLTVRTVGFNTJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|