C14H16N6 — CID 107110581
5-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]pyridine-2-carbonitrile (PubChem CID 107110581) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 107110581 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 5-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(n3ccc(N)n3)CC2)cn1 |
| InChI | InChI=1S/C14H16N6/c15-9-11-1-2-13(10-17-11)19-6-3-12(4-7-19)20-8-5-14(16)18-20/h1-2,5,8,10,12H,3-4,6-7H2,(H2,16,18) |
| InChIKey | LMUKMFIXWYFAGQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |