C13H15Br2N5 — CID 107110309
1-[1-(3,5-dibromo-2-pyridinyl)piperidin-4-yl]pyrazol-3-amine (PubChem CID 107110309) has the molecular formula C13H15Br2N5 and a molecular weight of 401.11 g/mol. Its IUPAC name is 1-[1-(3,5-dibromo-2-pyridinyl)piperidin-4-yl]pyrazol-3-amine.
| Compound Name | 1-[1-(3,5-dibromo-2-pyridinyl)piperidin-4-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 107110309 |
| Molecular Formula | C13H15Br2N5 |
| Molecular Weight | 401.11 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 1-[1-(3,5-dibromo-2-pyridinyl)piperidin-4-yl]pyrazol-3-amine |
| SMILES | Nc1ccn(C2CCN(c3ncc(Br)cc3Br)CC2)n1 |
| InChI | InChI=1S/C13H15Br2N5/c14-9-7-11(15)13(17-8-9)19-4-1-10(2-5-19)20-6-3-12(16)18-20/h3,6-8,10H,1-2,4-5H2,(H2,16,18) |
| InChIKey | TXFMWIBVPAANDE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |