C11H13Br3N2 — CID 102960994
3,5-dibromo-2-(3-bromo-4-methylpiperidin-1-yl)pyridine (PubChem CID 102960994) has the molecular formula C11H13Br3N2 and a molecular weight of 412.95 g/mol. Its IUPAC name is 3,5-dibromo-2-(3-bromo-4-methylpiperidin-1-yl)pyridine.
| Compound Name | 3,5-dibromo-2-(3-bromo-4-methylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 102960994 |
| Molecular Formula | C11H13Br3N2 |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 409.86 |
| IUPAC Name | 3,5-dibromo-2-(3-bromo-4-methylpiperidin-1-yl)pyridine |
| SMILES | CC1CCN(c2ncc(Br)cc2Br)CC1Br |
| InChI | InChI=1S/C11H13Br3N2/c1-7-2-3-16(6-10(7)14)11-9(13)4-8(12)5-15-11/h4-5,7,10H,2-3,6H2,1H3 |
| InChIKey | QCZNIIRYHBMOPF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|