C10H12Br2N2O — CID 131140975
1-(3,5-dibromo-2-pyridinyl)-4-methylpyrrolidin-3-ol (PubChem CID 131140975) has the molecular formula C10H12Br2N2O and a molecular weight of 336.03 g/mol. Its IUPAC name is 1-(3,5-dibromo-2-pyridinyl)-4-methylpyrrolidin-3-ol.
| Compound Name | 1-(3,5-dibromo-2-pyridinyl)-4-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 131140975 |
| Molecular Formula | C10H12Br2N2O |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 1-(3,5-dibromo-2-pyridinyl)-4-methylpyrrolidin-3-ol |
| SMILES | CC1CN(c2ncc(Br)cc2Br)CC1O |
| InChI | InChI=1S/C10H12Br2N2O/c1-6-4-14(5-9(6)15)10-8(12)2-7(11)3-13-10/h2-3,6,9,15H,4-5H2,1H3 |
| InChIKey | YBDGTICFVCKFPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |