C13H12ClN3OS — CID 107110958
2-[(5-chloro-2-pyridinyl)sulfanyl]-N'-hydroxy-3-methylbenzenecarboximidamide (PubChem CID 107110958) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)sulfanyl]-N'-hydroxy-3-methylbenzenecarboximidamide.
| Compound Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-N'-hydroxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107110958 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-N'-hydroxy-3-methylbenzenecarboximidamide |
| SMILES | Cc1cccc(/C(N)=N/O)c1Sc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H12ClN3OS/c1-8-3-2-4-10(13(15)17-18)12(8)19-11-6-5-9(14)7-16-11/h2-7,18H,1H3,(H2,15,17) |
| InChIKey | QGFYIKUHHRSIFI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|