C15H19N3O2S — CID 107112937
3-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-7-methyl-1-benzothiophene-2-carboxamide (PubChem CID 107112937) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-7-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-7-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107112937 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-amino-N-[1-(ethylamino)-1-oxopropan-2-yl]-7-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CCNC(=O)C(C)NC(=O)c1sc2c(C)cccc2c1N |
| InChI | InChI=1S/C15H19N3O2S/c1-4-17-14(19)9(3)18-15(20)13-11(16)10-7-5-6-8(2)12(10)21-13/h5-7,9H,4,16H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | PLVRHYHZUMFQPN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |